C22H23Cl2NO2 — CID 57290632
ethyl 3-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate (PubChem CID 57290632) has the molecular formula C22H23Cl2NO2 and a molecular weight of 404.34 g/mol. Its IUPAC name is ethyl 3-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate.
| Compound Name | ethyl 3-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 57290632 |
| Molecular Formula | C22H23Cl2NO2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | ethyl 3-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc2c(c1)[C@@H](NC)CC[C@H]2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl2NO2/c1-3-27-22(26)11-5-14-4-7-17-16(8-10-21(25-2)18(17)12-14)15-6-9-19(23)20(24)13-15/h4-7,9,11-13,16,21,25H,3,8,10H2,1-2H3/t16-,21-/m0/s1 |
| InChIKey | XFXGIWOFCKNTIJ-KKSFZXQISA-N |
| XLogP | 5.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|