About (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate (PubChem CID 163690395) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate.
Analyze (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate?
The IUPAC name of (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate (CID 163690395) is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate.
What is the SMILES notation for (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate?
The canonical SMILES for (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate is CCCC(C)C(=O)OC12CC3CC(C(=O)O1)C2C3.
What is the InChIKey of (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate?
The InChIKey is JSMQVZRPJXGEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-3-4-8(2)12(15)17-14-7-9-5-10(11(14)6-9)13(16)18-14/h8-11H,3-7H2,1-2H3.
What are the key properties of (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate?
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate has a molecular weight of 252.31 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylpentanoate is sourced from PubChem (CID 163690395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).