C27H38N4O5 — CID 163694109
tert-butyl 1-[[(2R)-1-methoxy-2,3,3-trimethyl-1-oxobutan-2-yl]carbamoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate (PubChem CID 163694109) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is tert-butyl 1-[[(2R)-1-methoxy-2,3,3-trimethyl-1-oxobutan-2-yl]carbamoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate.
| Compound Name | tert-butyl 1-[[(2R)-1-methoxy-2,3,3-trimethyl-1-oxobutan-2-yl]carbamoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate |
|---|---|
| PubChem CID | 163694109 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | tert-butyl 1-[[(2R)-1-methoxy-2,3,3-trimethyl-1-oxobutan-2-yl]carbamoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate |
| SMILES | COC(=O)[C@](C)(NC(=O)c1nc(-c2ccccc2)n2c1CN(C(=O)OC(C)(C)C)CCC2)C(C)(C)C |
| InChI | InChI=1S/C27H38N4O5/c1-25(2,3)27(7,23(33)35-8)29-22(32)20-19-17-30(24(34)36-26(4,5)6)15-12-16-31(19)21(28-20)18-13-10-9-11-14-18/h9-11,13-14H,12,15-17H2,1-8H3,(H,29,32)/t27-/m0/s1 |
| InChIKey | JVLSEEYTBNKSAX-MHZLTWQESA-N |
| XLogP | 4.40 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |