C26H37N5O4 — CID 66660185
tert-butyl 1-[[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-7-carboxylate (PubChem CID 66660185) has the molecular formula C26H37N5O4 and a molecular weight of 483.61 g/mol. Its IUPAC name is tert-butyl 1-[[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-7-carboxylate.
| Compound Name | tert-butyl 1-[[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-7-carboxylate |
|---|---|
| PubChem CID | 66660185 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | tert-butyl 1-[[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-7-carboxylate |
| SMILES | CNC(=O)C(NC(=O)c1nc(-c2ccccc2)n2c1CCN(C(=O)OC(C)(C)C)CC2)C(C)(C)C |
| InChI | InChI=1S/C26H37N5O4/c1-25(2,3)20(23(33)27-7)29-22(32)19-18-13-14-30(24(34)35-26(4,5)6)15-16-31(18)21(28-19)17-11-9-8-10-12-17/h8-12,20H,13-16H2,1-7H3,(H,27,33)(H,29,32) |
| InChIKey | ZJMDABIBOPKEBR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |