C25H37N5O2 — CID 66660410
N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-7-(2-methylpropyl)-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1-carboxamide (PubChem CID 66660410) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-7-(2-methylpropyl)-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1-carboxamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-7-(2-methylpropyl)-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 66660410 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-7-(2-methylpropyl)-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1-carboxamide |
| SMILES | CNC(=O)[C@@H](NC(=O)c1nc(-c2ccccc2)n2c1CCN(CC(C)C)CC2)C(C)(C)C |
| InChI | InChI=1S/C25H37N5O2/c1-17(2)16-29-13-12-19-20(23(31)28-21(24(32)26-6)25(3,4)5)27-22(30(19)15-14-29)18-10-8-7-9-11-18/h7-11,17,21H,12-16H2,1-6H3,(H,26,32)(H,28,31)/t21-/m1/s1 |
| InChIKey | FEUKTIBZLAYQKI-OAQYLSRUSA-N |
| XLogP | 2.95 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |