C28H33N5O3 — CID 66660313
7-benzoyl-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1-carboxamide (PubChem CID 66660313) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 7-benzoyl-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1-carboxamide.
| Compound Name | 7-benzoyl-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 66660313 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 7-benzoyl-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1-carboxamide |
| SMILES | CNC(=O)C(NC(=O)c1nc(-c2ccccc2)n2c1CCN(C(=O)c1ccccc1)CC2)C(C)(C)C |
| InChI | InChI=1S/C28H33N5O3/c1-28(2,3)23(26(35)29-4)31-25(34)22-21-15-16-32(27(36)20-13-9-6-10-14-20)17-18-33(21)24(30-22)19-11-7-5-8-12-19/h5-14,23H,15-18H2,1-4H3,(H,29,35)(H,31,34) |
| InChIKey | FRFKDUBNMUZVQT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |