C26H30N6O6S — CID 66931726
N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-7-(2-nitrophenyl)sulfonyl-3-phenyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxamide (PubChem CID 66931726) has the molecular formula C26H30N6O6S and a molecular weight of 554.63 g/mol. Its IUPAC name is N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-7-(2-nitrophenyl)sulfonyl-3-phenyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxamide.
| Compound Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-7-(2-nitrophenyl)sulfonyl-3-phenyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxamide |
|---|---|
| PubChem CID | 66931726 |
| Molecular Formula | C26H30N6O6S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-7-(2-nitrophenyl)sulfonyl-3-phenyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxamide |
| SMILES | CNC(=O)C(NC(=O)c1nc(-c2ccccc2)n2c1CN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2)C(C)(C)C |
| InChI | InChI=1S/C26H30N6O6S/c1-26(2,3)22(25(34)27-4)29-24(33)21-19-16-30(39(37,38)20-13-9-8-12-18(20)32(35)36)14-15-31(19)23(28-21)17-10-6-5-7-11-17/h5-13,22H,14-16H2,1-4H3,(H,27,34)(H,29,33) |
| InChIKey | ZYJBEYGRVAEPPP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 156.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|