C21H25BrO5 — CID 163695562
ethyl 5-acetyl-4-(4-bromophenyl)-2-butoxy-6-methyl-4H-pyran-3-carboxylate (PubChem CID 163695562) has the molecular formula C21H25BrO5 and a molecular weight of 437.33 g/mol. Its IUPAC name is ethyl 5-acetyl-4-(4-bromophenyl)-2-butoxy-6-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 5-acetyl-4-(4-bromophenyl)-2-butoxy-6-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 163695562 |
| Molecular Formula | C21H25BrO5 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | ethyl 5-acetyl-4-(4-bromophenyl)-2-butoxy-6-methyl-4H-pyran-3-carboxylate |
| SMILES | CCCCOC1=C(C(=O)OCC)C(c2ccc(Br)cc2)C(C(C)=O)=C(C)O1 |
| InChI | InChI=1S/C21H25BrO5/c1-5-7-12-26-21-19(20(24)25-6-2)18(15-8-10-16(22)11-9-15)17(13(3)23)14(4)27-21/h8-11,18H,5-7,12H2,1-4H3 |
| InChIKey | JWQSLBDXXUTWBG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|