C26H34N4O4 — CID 163695713
4-[2,4,5-tris(4-oxopentan-2-ylideneamino)phenyl]iminopentan-2-one (PubChem CID 163695713) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 4-[2,4,5-tris(4-oxopentan-2-ylideneamino)phenyl]iminopentan-2-one.
| Compound Name | 4-[2,4,5-tris(4-oxopentan-2-ylideneamino)phenyl]iminopentan-2-one |
|---|---|
| PubChem CID | 163695713 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 4-[2,4,5-tris(4-oxopentan-2-ylideneamino)phenyl]iminopentan-2-one |
| SMILES | CC(=O)C/C(C)=N/c1cc(/N=C(\C)CC(C)=O)c(/N=C(\C)CC(C)=O)cc1/N=C(\C)CC(C)=O |
| InChI | InChI=1S/C26H34N4O4/c1-15(9-19(5)31)27-23-13-25(29-17(3)11-21(7)33)26(30-18(4)12-22(8)34)14-24(23)28-16(2)10-20(6)32/h13-14H,9-12H2,1-8H3/b27-15+,28-16+,29-17+,30-18+ |
| InChIKey | JWTOVXOQJQOXLR-JMIZQSJKSA-N |
| XLogP | 5.97 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|