About (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione
(4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione (PubChem CID 163696091) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione.
Molecular Properties
| Compound Name | (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione |
| PubChem CID | 163696091 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione |
| SMILES | CC[C@@](O)(CC(C)=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H20O3/c1-6-11(14,7-8(2)12)9(13)10(3,4)5/h14H,6-7H2,1-5H3/t11-/m1/s1 |
| InChIKey | FVHDRSCNRMTYLF-LLVKDONJSA-N |
| XLogP | 1.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione?
The IUPAC name of (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione (CID 163696091) is (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione.
What is the SMILES notation for (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione?
The canonical SMILES for (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione is CC[C@@](O)(CC(C)=O)C(=O)C(C)(C)C.
What is the InChIKey of (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione?
The InChIKey is FVHDRSCNRMTYLF-LLVKDONJSA-N. The full InChI is InChI=1S/C11H20O3/c1-6-11(14,7-8(2)12)9(13)10(3,4)5/h14H,6-7H2,1-5H3/t11-/m1/s1.
What are the key properties of (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione?
(4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione has a molecular weight of 200.28 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-ethyl-4-hydroxy-6,6-dimethylheptane-2,5-dione is sourced from PubChem (CID 163696091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).