C15H28O3 — CID 163886257
(4R)-4-(3,3-dimethylbut-1-en-2-yl)-4,7-dihydroxy-7-methyloctan-2-one (PubChem CID 163886257) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (4R)-4-(3,3-dimethylbut-1-en-2-yl)-4,7-dihydroxy-7-methyloctan-2-one.
| Compound Name | (4R)-4-(3,3-dimethylbut-1-en-2-yl)-4,7-dihydroxy-7-methyloctan-2-one |
|---|---|
| PubChem CID | 163886257 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (4R)-4-(3,3-dimethylbut-1-en-2-yl)-4,7-dihydroxy-7-methyloctan-2-one |
| SMILES | C=C(C(C)(C)C)[C@@](O)(CCC(C)(C)O)CC(C)=O |
| InChI | InChI=1S/C15H28O3/c1-11(16)10-15(18,9-8-14(6,7)17)12(2)13(3,4)5/h17-18H,2,8-10H2,1,3-7H3/t15-/m1/s1 |
| InChIKey | HXJOLYMVKWXGDZ-OAHLLOKOSA-N |
| XLogP | 2.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|