C13H20 — CID 163700219
(1S)-6,7-dimethyltricyclo[6.2.1.02,5]undec-2-ene (PubChem CID 163700219) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (1S)-6,7-dimethyltricyclo[6.2.1.02,5]undec-2-ene.
| Compound Name | (1S)-6,7-dimethyltricyclo[6.2.1.02,5]undec-2-ene |
|---|---|
| PubChem CID | 163700219 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (1S)-6,7-dimethyltricyclo[6.2.1.02,5]undec-2-ene |
| SMILES | CC1C2CC[C@@H](C2)C2=CCC2C1C |
| InChI | InChI=1S/C13H20/c1-8-9(2)12-5-6-13(12)11-4-3-10(8)7-11/h6,8-12H,3-5,7H2,1-2H3/t8?,9?,10?,11-,12?/m0/s1 |
| InChIKey | KAISLEPCZUISJV-CRCJWISWSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|