About tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene
tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene (PubChem CID 163701777) has the molecular formula C10H6
and a molecular weight of 126.16 g/mol. Its IUPAC name is tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene.
Analyze tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene?
The IUPAC name of tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene (CID 163701777) is tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene.
What is the SMILES notation for tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene?
The canonical SMILES for tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene is c1cc2c3c4c1c(c24)CC3.
What is the InChIKey of tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene?
The InChIKey is KBQARYKXBHUBEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6/c1-2-6-8-4-3-7-5(1)9(8)10(6)7/h1-2H,3-4H2.
What are the key properties of tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene?
tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene has a molecular weight of 126.16 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[4.4.0.02,7.03,8]deca-1(6),2(7),3(8),4-tetraene is sourced from PubChem (CID 163701777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).