C8H13NO2 — CID 163701779
1-(3-aminocyclohexa-1,5-dien-1-yl)ethane-1,2-diol (PubChem CID 163701779) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 1-(3-aminocyclohexa-1,5-dien-1-yl)ethane-1,2-diol.
| Compound Name | 1-(3-aminocyclohexa-1,5-dien-1-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 163701779 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 1-(3-aminocyclohexa-1,5-dien-1-yl)ethane-1,2-diol |
| SMILES | NC1C=C(C(O)CO)C=CC1 |
| InChI | InChI=1S/C8H13NO2/c9-7-3-1-2-6(4-7)8(11)5-10/h1-2,4,7-8,10-11H,3,5,9H2 |
| InChIKey | KBQBULPSHKTBCL-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |