C11H20O — CID 163709436
(5Z,7Z)-3,3-dimethyl-2,4-dihydrooxocine;ethane (PubChem CID 163709436) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (5Z,7Z)-3,3-dimethyl-2,4-dihydrooxocine;ethane.
| Compound Name | (5Z,7Z)-3,3-dimethyl-2,4-dihydrooxocine;ethane |
|---|---|
| PubChem CID | 163709436 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (5Z,7Z)-3,3-dimethyl-2,4-dihydrooxocine;ethane |
| SMILES | CC.CC1(C)C/C=C\C=C/OC1 |
| InChI | InChI=1S/C9H14O.C2H6/c1-9(2)6-4-3-5-7-10-8-9;1-2/h3-5,7H,6,8H2,1-2H3;1-2H3/b4-3-,7-5-; |
| InChIKey | KHWPWBBCFMWHLM-RYQTYZJISA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |