C10H18N2 — CID 163717043
N-cyclohex-2-en-1-yl-N,N'-dimethylethanimidamide (PubChem CID 163717043) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-N,N'-dimethylethanimidamide.
| Compound Name | N-cyclohex-2-en-1-yl-N,N'-dimethylethanimidamide |
|---|---|
| PubChem CID | 163717043 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-cyclohex-2-en-1-yl-N,N'-dimethylethanimidamide |
| SMILES | C/N=C(\C)N(C)C1C=CCCC1 |
| InChI | InChI=1S/C10H18N2/c1-9(11-2)12(3)10-7-5-4-6-8-10/h5,7,10H,4,6,8H2,1-3H3/b11-9+ |
| InChIKey | KOGOTROMXDXSMA-PKNBQFBNSA-N |
| XLogP | 2.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|