C25H48O2 — CID 163717104
2-butan-2-yl-1-(1,1-dicyclohexylethoxy)-3-methylhexan-1-ol (PubChem CID 163717104) has the molecular formula C25H48O2 and a molecular weight of 380.66 g/mol. Its IUPAC name is 2-butan-2-yl-1-(1,1-dicyclohexylethoxy)-3-methylhexan-1-ol.
| Compound Name | 2-butan-2-yl-1-(1,1-dicyclohexylethoxy)-3-methylhexan-1-ol |
|---|---|
| PubChem CID | 163717104 |
| Molecular Formula | C25H48O2 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.37 |
| IUPAC Name | 2-butan-2-yl-1-(1,1-dicyclohexylethoxy)-3-methylhexan-1-ol |
| SMILES | CCCC(C)C(C(C)CC)C(O)OC(C)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H48O2/c1-6-14-20(4)23(19(3)7-2)24(26)27-25(5,21-15-10-8-11-16-21)22-17-12-9-13-18-22/h19-24,26H,6-18H2,1-5H3 |
| InChIKey | KOHVFDSRGASXLK-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|