C20H22N2O2 — CID 163719180
(2E,4Z)-6-[2-(benzylamino)phenyl]-6-imino-2-methylhexa-2,4-diene-1,5-diol (PubChem CID 163719180) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2E,4Z)-6-[2-(benzylamino)phenyl]-6-imino-2-methylhexa-2,4-diene-1,5-diol.
| Compound Name | (2E,4Z)-6-[2-(benzylamino)phenyl]-6-imino-2-methylhexa-2,4-diene-1,5-diol |
|---|---|
| PubChem CID | 163719180 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2E,4Z)-6-[2-(benzylamino)phenyl]-6-imino-2-methylhexa-2,4-diene-1,5-diol |
| SMILES | [H]/N=C(C(\O)=C\C=C(/C)CO)/c1ccccc1NCc1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c1-15(14-23)11-12-19(24)20(21)17-9-5-6-10-18(17)22-13-16-7-3-2-4-8-16/h2-12,21-24H,13-14H2,1H3/b15-11+,19-12-,21-20- |
| InChIKey | KQAIGJAVKRTCKN-QUOQWLRSSA-N |
| XLogP | 4.05 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|