C34H33ClN6O4 — CID 163725955
(Z)-2-[[4-[4-[2-(1-anilino-3-oxobutan-2-ylidene)hydrazinyl]-3-chlorophenyl]-2-methylphenyl]diazenyl]-3-hydroxy-N-(4-methoxyphenyl)but-2-enamide (PubChem CID 163725955) has the molecular formula C34H33ClN6O4 and a molecular weight of 625.13 g/mol. Its IUPAC name is (Z)-2-[[4-[4-[2-(1-anilino-3-oxobutan-2-ylidene)hydrazinyl]-3-chlorophenyl]-2-methylphenyl]diazenyl]-3-hydroxy-N-(4-methoxyphenyl)but-2-enamide.
| Compound Name | (Z)-2-[[4-[4-[2-(1-anilino-3-oxobutan-2-ylidene)hydrazinyl]-3-chlorophenyl]-2-methylphenyl]diazenyl]-3-hydroxy-N-(4-methoxyphenyl)but-2-enamide |
|---|---|
| PubChem CID | 163725955 |
| Molecular Formula | C34H33ClN6O4 |
| Molecular Weight | 625.13 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | (Z)-2-[[4-[4-[2-(1-anilino-3-oxobutan-2-ylidene)hydrazinyl]-3-chlorophenyl]-2-methylphenyl]diazenyl]-3-hydroxy-N-(4-methoxyphenyl)but-2-enamide |
| SMILES | COc1ccc(NC(=O)C(/N=N/c2ccc(-c3ccc(NN=C(CNc4ccccc4)C(C)=O)c(Cl)c3)cc2C)=C(\C)O)cc1 |
| InChI | InChI=1S/C34H33ClN6O4/c1-21-18-24(10-16-30(21)38-41-33(23(3)43)34(44)37-27-12-14-28(45-4)15-13-27)25-11-17-31(29(35)19-25)39-40-32(22(2)42)20-36-26-8-6-5-7-9-26/h5-19,36,39,43H,20H2,1-4H3,(H,37,44)/b33-23-,40-32?,41-38+ |
| InChIKey | VWUNACHSCZMMBB-SEDBCGEQSA-N |
| XLogP | 8.30 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.13 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|