C22H38N6O5S — CID 163727290
4-[[4-[[ethyl-[2-[2-hydroxypropyl-[2-[[(2S)-2-hydroxypropyl]amino]ethyl]amino]ethyl]amino]methyl]triazol-1-yl]methyl]benzenesulfonic acid (PubChem CID 163727290) has the molecular formula C22H38N6O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-[[4-[[ethyl-[2-[2-hydroxypropyl-[2-[[(2S)-2-hydroxypropyl]amino]ethyl]amino]ethyl]amino]methyl]triazol-1-yl]methyl]benzenesulfonic acid.
| Compound Name | 4-[[4-[[ethyl-[2-[2-hydroxypropyl-[2-[[(2S)-2-hydroxypropyl]amino]ethyl]amino]ethyl]amino]methyl]triazol-1-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 163727290 |
| Molecular Formula | C22H38N6O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 4-[[4-[[ethyl-[2-[2-hydroxypropyl-[2-[[(2S)-2-hydroxypropyl]amino]ethyl]amino]ethyl]amino]methyl]triazol-1-yl]methyl]benzenesulfonic acid |
| SMILES | CCN(CCN(CCNC[C@H](C)O)CC(C)O)Cc1cn(Cc2ccc(S(=O)(=O)O)cc2)nn1 |
| InChI | InChI=1S/C22H38N6O5S/c1-4-26(11-12-27(14-19(3)30)10-9-23-13-18(2)29)16-21-17-28(25-24-21)15-20-5-7-22(8-6-20)34(31,32)33/h5-8,17-19,23,29-30H,4,9-16H2,1-3H3,(H,31,32,33)/t18-,19?/m0/s1 |
| InChIKey | KWRJVHMZSHBVOC-OYKVQYDMSA-N |
| XLogP | 0.05 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|