C29H32N4O7S — CID 163729303
[1-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]azetidin-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 163729303) has the molecular formula C29H32N4O7S and a molecular weight of 580.66 g/mol. Its IUPAC name is [1-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]azetidin-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [1-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]azetidin-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 163729303 |
| Molecular Formula | C29H32N4O7S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | [1-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]azetidin-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CN(C3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)C2)cc1 |
| InChI | InChI=1S/C29H32N4O7S/c1-18-2-5-22(6-3-18)41(38,39)40-17-19-15-32(16-19)20-10-12-31(13-11-20)21-4-7-23-24(14-21)29(37)33(28(23)36)25-8-9-26(34)30-27(25)35/h2-7,14,19-20,25H,8-13,15-17H2,1H3,(H,30,34,35) |
| InChIKey | GTEVAZJMEYNQGK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|