C15H17ClIN5O — CID 163730469
4-[3-(8-chloro-1-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]piperazine-1-carbaldehyde (PubChem CID 163730469) has the molecular formula C15H17ClIN5O and a molecular weight of 445.69 g/mol. Its IUPAC name is 4-[3-(8-chloro-1-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(8-chloro-1-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 163730469 |
| Molecular Formula | C15H17ClIN5O |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 4-[3-(8-chloro-1-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C2CC(c3nc(I)c4c(Cl)nccn34)C2)CC1 |
| InChI | InChI=1S/C15H17ClIN5O/c16-13-12-14(17)19-15(22(12)2-1-18-13)10-7-11(8-10)21-5-3-20(9-23)4-6-21/h1-2,9-11H,3-8H2 |
| InChIKey | KZDBZEVUDUTLFN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|