C17H25ClIN3OSi — CID 154084227
[1-[3-(8-chloro-1-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]-2,2-dimethylpropoxy]-dimethylsilane (PubChem CID 154084227) has the molecular formula C17H25ClIN3OSi and a molecular weight of 477.85 g/mol. Its IUPAC name is [1-[3-(8-chloro-1-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]-2,2-dimethylpropoxy]-dimethylsilane.
| Compound Name | [1-[3-(8-chloro-1-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]-2,2-dimethylpropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154084227 |
| Molecular Formula | C17H25ClIN3OSi |
| Molecular Weight | 477.85 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | [1-[3-(8-chloro-1-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]-2,2-dimethylpropoxy]-dimethylsilane |
| SMILES | C[SiH](C)OC(C1CC(c2nc(I)c3c(Cl)nccn23)C1)C(C)(C)C |
| InChI | InChI=1S/C17H25ClIN3OSi/c1-17(2,3)13(23-24(4)5)10-8-11(9-10)16-21-15(19)12-14(18)20-6-7-22(12)16/h6-7,10-11,13,24H,8-9H2,1-5H3 |
| InChIKey | NEUNWEUINKSDOJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.85 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|