C21H24ClN3O2 — CID 88907381
1-(3-butoxy-4-methoxyphenyl)-8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine (PubChem CID 88907381) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 1-(3-butoxy-4-methoxyphenyl)-8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine.
| Compound Name | 1-(3-butoxy-4-methoxyphenyl)-8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 88907381 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-(3-butoxy-4-methoxyphenyl)-8-chloro-3-cyclobutylimidazo[1,5-a]pyrazine |
| SMILES | CCCCOc1cc(-c2nc(C3CCC3)n3ccnc(Cl)c23)ccc1OC |
| InChI | InChI=1S/C21H24ClN3O2/c1-3-4-12-27-17-13-15(8-9-16(17)26-2)18-19-20(22)23-10-11-25(19)21(24-18)14-6-5-7-14/h8-11,13-14H,3-7,12H2,1-2H3 |
| InChIKey | RXGDLROCLWIXRC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|