C21H29BrN4O5 — CID 163731404
ethyl 4-bromo-1-methyl-3-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]phenoxy]methyl]pyrazole-5-carboxylate (PubChem CID 163731404) has the molecular formula C21H29BrN4O5 and a molecular weight of 497.39 g/mol. Its IUPAC name is ethyl 4-bromo-1-methyl-3-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]phenoxy]methyl]pyrazole-5-carboxylate.
| Compound Name | ethyl 4-bromo-1-methyl-3-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]phenoxy]methyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 163731404 |
| Molecular Formula | C21H29BrN4O5 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | ethyl 4-bromo-1-methyl-3-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]phenoxy]methyl]pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(Br)c(COc2ccc(NCCNC(=O)OC(C)(C)C)cc2)nn1C |
| InChI | InChI=1S/C21H29BrN4O5/c1-6-29-19(27)18-17(22)16(25-26(18)5)13-30-15-9-7-14(8-10-15)23-11-12-24-20(28)31-21(2,3)4/h7-10,23H,6,11-13H2,1-5H3,(H,24,28) |
| InChIKey | KZVSLOCXVWQNAQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|