C24H26Cl2N2O3 — CID 163733947
N-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-4-hydroxy-5-oxo-1-(4-phenylbutyl)pyrrolidine-3-carboxamide (PubChem CID 163733947) has the molecular formula C24H26Cl2N2O3 and a molecular weight of 461.39 g/mol. Its IUPAC name is N-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-4-hydroxy-5-oxo-1-(4-phenylbutyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-4-hydroxy-5-oxo-1-(4-phenylbutyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 163733947 |
| Molecular Formula | C24H26Cl2N2O3 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-4-hydroxy-5-oxo-1-(4-phenylbutyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NC/C=C/c1ccc(Cl)c(Cl)c1)C1CN(CCCCc2ccccc2)C(=O)C1O |
| InChI | InChI=1S/C24H26Cl2N2O3/c25-20-12-11-18(15-21(20)26)10-6-13-27-23(30)19-16-28(24(31)22(19)29)14-5-4-9-17-7-2-1-3-8-17/h1-3,6-8,10-12,15,19,22,29H,4-5,9,13-14,16H2,(H,27,30)/b10-6+ |
| InChIKey | LBZPTTCXWYWFQH-UXBLZVDNSA-N |
| XLogP | 3.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|