C20H25N5S — CID 163736430
N'-[4-[[4-(2,3-dihydropyrazin-5-yl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 163736430) has the molecular formula C20H25N5S and a molecular weight of 367.52 g/mol. Its IUPAC name is N'-[4-[[4-(2,3-dihydropyrazin-5-yl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[[4-(2,3-dihydropyrazin-5-yl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 163736430 |
| Molecular Formula | C20H25N5S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N'-[4-[[4-(2,3-dihydropyrazin-5-yl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(C3=NCCN=C3)cs2)cc1C |
| InChI | InChI=1S/C20H25N5S/c1-5-25(4)13-23-17-9-14(2)16(8-15(17)3)10-20-24-19(12-26-20)18-11-21-6-7-22-18/h8-9,11-13H,5-7,10H2,1-4H3/b23-13+ |
| InChIKey | LDZLPCAJVOBZLT-YDZHTSKRSA-N |
| XLogP | 3.84 |
| TPSA | 53.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|