C18H27Cl2N3S — CID 90185197
N-ethyl-N'-[4-[(4-ethyl-1,3-thiazol-2-yl)methyl]-2,5-dimethylphenyl]-N-methylmethanimidamide;dihydrochloride (PubChem CID 90185197) has the molecular formula C18H27Cl2N3S and a molecular weight of 388.41 g/mol. Its IUPAC name is N-ethyl-N'-[4-[(4-ethyl-1,3-thiazol-2-yl)methyl]-2,5-dimethylphenyl]-N-methylmethanimidamide;dihydrochloride.
| Compound Name | N-ethyl-N'-[4-[(4-ethyl-1,3-thiazol-2-yl)methyl]-2,5-dimethylphenyl]-N-methylmethanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 90185197 |
| Molecular Formula | C18H27Cl2N3S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-ethyl-N'-[4-[(4-ethyl-1,3-thiazol-2-yl)methyl]-2,5-dimethylphenyl]-N-methylmethanimidamide;dihydrochloride |
| SMILES | CCc1csc(Cc2cc(C)c(/N=C/N(C)CC)cc2C)n1.Cl.Cl |
| InChI | InChI=1S/C18H25N3S.2ClH/c1-6-16-11-22-18(20-16)10-15-8-14(4)17(9-13(15)3)19-12-21(5)7-2;;/h8-9,11-12H,6-7,10H2,1-5H3;2*1H/b19-12+;; |
| InChIKey | DVNSSBPZWIDJJW-SWFGUFHISA-N |
| XLogP | 5.37 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|