C6H7IO3 — CID 163739346
trans-(1R,2R)-2-hydroxy-4-oxocyclopentane-1-carbonyl iodide (PubChem CID 163739346) has the molecular formula C6H7IO3 and a molecular weight of 254.02 g/mol. Its IUPAC name is trans-(1R,2R)-2-hydroxy-4-oxocyclopentane-1-carbonyl iodide.
| Compound Name | trans-(1R,2R)-2-hydroxy-4-oxocyclopentane-1-carbonyl iodide |
|---|---|
| PubChem CID | 163739346 |
| Molecular Formula | C6H7IO3 |
| Molecular Weight | 254.02 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | trans-(1R,2R)-2-hydroxy-4-oxocyclopentane-1-carbonyl iodide |
| SMILES | O=C1C[C@@H](O)[C@H](C(=O)I)C1 |
| InChI | InChI=1S/C6H7IO3/c7-6(10)4-1-3(8)2-5(4)9/h4-5,9H,1-2H2/t4-,5-/m1/s1 |
| InChIKey | LGKFVKCXKFMJOB-RFZPGFLSSA-N |
| XLogP | 0.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.02 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|