C18H18N2O4S — CID 163739829
4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1,3-thiazol-4-yl]-1-methylcyclohexa-3,5-diene-1,3-diol (PubChem CID 163739829) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1,3-thiazol-4-yl]-1-methylcyclohexa-3,5-diene-1,3-diol.
| Compound Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1,3-thiazol-4-yl]-1-methylcyclohexa-3,5-diene-1,3-diol |
|---|---|
| PubChem CID | 163739829 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1,3-thiazol-4-yl]-1-methylcyclohexa-3,5-diene-1,3-diol |
| SMILES | CC1(O)C=CC(c2csc(Nc3ccc4c(c3)OCCO4)n2)=C(O)C1 |
| InChI | InChI=1S/C18H18N2O4S/c1-18(22)5-4-12(14(21)9-18)13-10-25-17(20-13)19-11-2-3-15-16(8-11)24-7-6-23-15/h2-5,8,10,21-22H,6-7,9H2,1H3,(H,19,20) |
| InChIKey | LGULCCJNDJOYMH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |