About [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium
[[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium (PubChem CID 163747293) has the molecular formula C8H17IN+
and a molecular weight of 254.13 g/mol. Its IUPAC name is [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium.
Molecular Properties
| Compound Name | [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium |
| PubChem CID | 163747293 |
| Molecular Formula | C8H17IN+ |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium |
| SMILES | C/C=C(/CCC)C/I=[NH+]/C |
| InChI | InChI=1S/C8H16IN/c1-4-6-8(5-2)7-9-10-3/h5H,4,6-7H2,1-3H3/p+1/b8-5- |
| InChIKey | LMYMOEFEVAZJLJ-YVMONPNESA-O |
| XLogP | 1.60 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium?
The IUPAC name of [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium (CID 163747293) is [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium.
What is the SMILES notation for [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium?
The canonical SMILES for [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium is C/C=C(/CCC)C/I=[NH+]/C.
What is the InChIKey of [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium?
The InChIKey is LMYMOEFEVAZJLJ-YVMONPNESA-O. The full InChI is InChI=1S/C8H16IN/c1-4-6-8(5-2)7-9-10-3/h5H,4,6-7H2,1-3H3/p+1/b8-5-.
What are the key properties of [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium?
[[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium has a molecular weight of 254.13 g/mol, XLogP of 1.60, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2Z)-2-ethylidenepentyl]-λ3-iodanylidene]-methylazanium is sourced from PubChem (CID 163747293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).