C9H10N3- — CID 163751079
(1-methyl-8aH-1,5-naphthyridin-4-yl)azanide (PubChem CID 163751079) has the molecular formula C9H10N3- and a molecular weight of 160.20 g/mol. Its IUPAC name is (1-methyl-8aH-1,5-naphthyridin-4-yl)azanide.
| Compound Name | (1-methyl-8aH-1,5-naphthyridin-4-yl)azanide |
|---|---|
| PubChem CID | 163751079 |
| Molecular Formula | C9H10N3- |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (1-methyl-8aH-1,5-naphthyridin-4-yl)azanide |
| SMILES | CN1C=CC([NH-])=C2N=CC=CC21 |
| InChI | InChI=1S/C9H10N3/c1-12-6-4-7(10)9-8(12)3-2-5-11-9/h2-6,8,10H,1H3/q-1 |
| InChIKey | LQAKFPABZTXEBO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 39.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |