C9H10N2 — CID 144750353
6-methyl-6,7-dihydro-1,7-naphthyridine (PubChem CID 144750353) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 6-methyl-6,7-dihydro-1,7-naphthyridine.
| Compound Name | 6-methyl-6,7-dihydro-1,7-naphthyridine |
|---|---|
| PubChem CID | 144750353 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 6-methyl-6,7-dihydro-1,7-naphthyridine |
| SMILES | CC1C=c2cccnc2=CN1 |
| InChI | InChI=1S/C9H10N2/c1-7-5-8-3-2-4-10-9(8)6-11-7/h2-7,11H,1H3 |
| InChIKey | DLISXZUDASTTAQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |