C9H11N3 — CID 163751080
1-methyl-8aH-1,5-naphthyridin-4-amine (PubChem CID 163751080) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 1-methyl-8aH-1,5-naphthyridin-4-amine.
| Compound Name | 1-methyl-8aH-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 163751080 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1-methyl-8aH-1,5-naphthyridin-4-amine |
| SMILES | CN1C=CC(N)=C2N=CC=CC21 |
| InChI | InChI=1S/C9H11N3/c1-12-6-4-7(10)9-8(12)3-2-5-11-9/h2-6,8H,10H2,1H3 |
| InChIKey | AOVSDYPHOJFSGA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |