C50H57F3N2O3 — CID 163754598
1-[2-[3-[5-butoxy-8-(butylamino)naphthalen-1-yl]buta-1,3-dienyl]-5-[2-(6-butoxy-1-butylbenzo[cd]indol-2-ylidene)ethylidene]cyclopenten-1-yl]-2,2,2-trifluoroethanone (PubChem CID 163754598) has the molecular formula C50H57F3N2O3 and a molecular weight of 791.01 g/mol. Its IUPAC name is 1-[2-[3-[5-butoxy-8-(butylamino)naphthalen-1-yl]buta-1,3-dienyl]-5-[2-(6-butoxy-1-butylbenzo[cd]indol-2-ylidene)ethylidene]cyclopenten-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-[3-[5-butoxy-8-(butylamino)naphthalen-1-yl]buta-1,3-dienyl]-5-[2-(6-butoxy-1-butylbenzo[cd]indol-2-ylidene)ethylidene]cyclopenten-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 163754598 |
| Molecular Formula | C50H57F3N2O3 |
| Molecular Weight | 791.01 g/mol |
| Exact Mass | 790.43 |
| IUPAC Name | 1-[2-[3-[5-butoxy-8-(butylamino)naphthalen-1-yl]buta-1,3-dienyl]-5-[2-(6-butoxy-1-butylbenzo[cd]indol-2-ylidene)ethylidene]cyclopenten-1-yl]-2,2,2-trifluoroethanone |
| SMILES | C=C(C=CC1=C(C(=O)C(F)(F)F)C(=CC=c2c3cccc4c(OCCCC)ccc(c43)n2CCCC)CC1)c1cccc2c(OCCCC)ccc(NCCCC)c12 |
| InChI | InChI=1S/C50H57F3N2O3/c1-6-10-30-54-41-25-28-44(57-32-12-8-3)39-18-14-16-37(47(39)41)34(5)20-21-35-22-23-36(46(35)49(56)50(51,52)53)24-26-42-38-17-15-19-40-45(58-33-13-9-4)29-27-43(48(38)40)55(42)31-11-7-2/h14-21,24-29,54H,5-13,22-23,30-33H2,1-4H3 |
| InChIKey | LSYIOUNDCMEHCZ-UHFFFAOYSA-N |
| XLogP | 13.23 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.01 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|