C32H35NO3S — CID 122536627
3-[(4E,6E,8E)-8-(1-butylbenzo[cd]indol-2-ylidene)-2-methyl-3-methylideneocta-4,6-dien-2-yl]-4-methylbenzenesulfonic acid (PubChem CID 122536627) has the molecular formula C32H35NO3S and a molecular weight of 513.70 g/mol. Its IUPAC name is 3-[(4E,6E,8E)-8-(1-butylbenzo[cd]indol-2-ylidene)-2-methyl-3-methylideneocta-4,6-dien-2-yl]-4-methylbenzenesulfonic acid.
| Compound Name | 3-[(4E,6E,8E)-8-(1-butylbenzo[cd]indol-2-ylidene)-2-methyl-3-methylideneocta-4,6-dien-2-yl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 122536627 |
| Molecular Formula | C32H35NO3S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 3-[(4E,6E,8E)-8-(1-butylbenzo[cd]indol-2-ylidene)-2-methyl-3-methylideneocta-4,6-dien-2-yl]-4-methylbenzenesulfonic acid |
| SMILES | C=C(/C=C/C=C/C=c1\c2cccc3cccc(c32)n1CCCC)C(C)(C)c1cc(S(=O)(=O)O)ccc1C |
| InChI | InChI=1S/C32H35NO3S/c1-6-7-21-33-29(27-16-11-14-25-15-12-18-30(33)31(25)27)17-10-8-9-13-24(3)32(4,5)28-22-26(37(34,35)36)20-19-23(28)2/h8-20,22H,3,6-7,21H2,1-2,4-5H3,(H,34,35,36)/b10-8+,13-9+,29-17+ |
| InChIKey | BHJCVCLYYGSJLL-LSZAUOKYSA-N |
| XLogP | 7.30 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|