C24H26O3 — CID 163756950
(14R)-14,16-ditert-butyl-15,18-dioxapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-1(17),4,6,8,10,12-hexaen-3-one (PubChem CID 163756950) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is (14R)-14,16-ditert-butyl-15,18-dioxapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-1(17),4,6,8,10,12-hexaen-3-one.
| Compound Name | (14R)-14,16-ditert-butyl-15,18-dioxapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-1(17),4,6,8,10,12-hexaen-3-one |
|---|---|
| PubChem CID | 163756950 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (14R)-14,16-ditert-butyl-15,18-dioxapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-1(17),4,6,8,10,12-hexaen-3-one |
| SMILES | CC(C)(C)C1OC(C(C)(C)C)c2c3oc(c21)C1=Cc2ccccc2C(=O)C13 |
| InChI | InChI=1S/C24H26O3/c1-23(2,3)21-16-17(22(27-21)24(4,5)6)20-15-14(19(16)26-20)11-12-9-7-8-10-13(12)18(15)25/h7-11,15,21-22H,1-6H3 |
| InChIKey | LUXBMLRHZMMNLB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |