About 3-fluoro-9,10-dioxoanthracene-2-diazonium
3-fluoro-9,10-dioxoanthracene-2-diazonium (PubChem CID 163760469) has the molecular formula C14H6FN2O2+
and a molecular weight of 253.21 g/mol. Its IUPAC name is 3-fluoro-9,10-dioxoanthracene-2-diazonium.
Molecular Properties
| Compound Name | 3-fluoro-9,10-dioxoanthracene-2-diazonium |
| PubChem CID | 163760469 |
| Molecular Formula | C14H6FN2O2+ |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-fluoro-9,10-dioxoanthracene-2-diazonium |
| SMILES | N#[N+]c1cc2c(cc1F)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H6FN2O2/c15-11-5-9-10(6-12(11)17-16)14(19)8-4-2-1-3-7(8)13(9)18/h1-6H/q+1 |
| InChIKey | LXTFWTYKNXITNH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-9,10-dioxoanthracene-2-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-9,10-dioxoanthracene-2-diazonium?
The IUPAC name of 3-fluoro-9,10-dioxoanthracene-2-diazonium (CID 163760469) is 3-fluoro-9,10-dioxoanthracene-2-diazonium.
What is the SMILES notation for 3-fluoro-9,10-dioxoanthracene-2-diazonium?
The canonical SMILES for 3-fluoro-9,10-dioxoanthracene-2-diazonium is N#[N+]c1cc2c(cc1F)C(=O)c1ccccc1C2=O.
What is the InChIKey of 3-fluoro-9,10-dioxoanthracene-2-diazonium?
The InChIKey is LXTFWTYKNXITNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6FN2O2/c15-11-5-9-10(6-12(11)17-16)14(19)8-4-2-1-3-7(8)13(9)18/h1-6H/q+1.
What are the key properties of 3-fluoro-9,10-dioxoanthracene-2-diazonium?
3-fluoro-9,10-dioxoanthracene-2-diazonium has a molecular weight of 253.21 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-9,10-dioxoanthracene-2-diazonium is sourced from PubChem (CID 163760469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).