C11H17NO — CID 163762515
5-cyclohex-2-en-1-yl-3-iminopentan-2-one (PubChem CID 163762515) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 5-cyclohex-2-en-1-yl-3-iminopentan-2-one.
| Compound Name | 5-cyclohex-2-en-1-yl-3-iminopentan-2-one |
|---|---|
| PubChem CID | 163762515 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 5-cyclohex-2-en-1-yl-3-iminopentan-2-one |
| SMILES | [H]/N=C(/CCC1C=CCCC1)C(C)=O |
| InChI | InChI=1S/C11H17NO/c1-9(13)11(12)8-7-10-5-3-2-4-6-10/h3,5,10,12H,2,4,6-8H2,1H3/b12-11- |
| InChIKey | LZKGAKPSGDVVRB-QXMHVHEDSA-N |
| XLogP | 2.73 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|