C18H34N4O4 — CID 163764049
(4S)-10-[2-(2-azidoethoxy)ethoxy]-2-methyl-4-(propan-2-ylamino)decane-3,7-dione (PubChem CID 163764049) has the molecular formula C18H34N4O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (4S)-10-[2-(2-azidoethoxy)ethoxy]-2-methyl-4-(propan-2-ylamino)decane-3,7-dione.
| Compound Name | (4S)-10-[2-(2-azidoethoxy)ethoxy]-2-methyl-4-(propan-2-ylamino)decane-3,7-dione |
|---|---|
| PubChem CID | 163764049 |
| Molecular Formula | C18H34N4O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | (4S)-10-[2-(2-azidoethoxy)ethoxy]-2-methyl-4-(propan-2-ylamino)decane-3,7-dione |
| SMILES | CC(C)N[C@@H](CCC(=O)CCCOCCOCCN=[N+]=[N-])C(=O)C(C)C |
| InChI | InChI=1S/C18H34N4O4/c1-14(2)18(24)17(21-15(3)4)8-7-16(23)6-5-10-25-12-13-26-11-9-20-22-19/h14-15,17,21H,5-13H2,1-4H3/t17-/m0/s1 |
| InChIKey | SHTUYBCWLVMYNF-KRWDZBQOSA-N |
| XLogP | 3.05 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|