C24H24B2FN7O11P2 — CID 163764228
CID 163764228 (PubChem CID 163764228) has the molecular formula C24H24B2FN7O11P2 and a molecular weight of 689.06 g/mol.
| Compound Name | CID 163764228 |
|---|---|
| PubChem CID | 163764228 |
| Molecular Formula | C24H24B2FN7O11P2 |
| Molecular Weight | 689.06 g/mol |
| Exact Mass | 689.12 |
| IUPAC Name | — |
| SMILES | [B]P1(=O)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]cnc43)C(O)[C@H]2OP([B])(=O)OC[C@H]2O[C@@H](n3cc4c5c(ccnc53)NOCC4)[C@@H](F)C2O1 |
| InChI | InChI=1S/C24H24B2FN7O11P2/c25-46(37)41-7-13-19(17(35)24(43-13)34-9-31-16-21(34)29-8-30-22(16)36)45-47(26,38)40-6-12-18(44-46)15(27)23(42-12)33-5-10-2-4-39-32-11-1-3-28-20(33)14(10)11/h1,3,5,8-9,12-13,15,17-19,23-24,32,35H,2,4,6-7H2,(H,29,30,36)/t12-,13-,15+,17?,18?,19+,23-,24-,46?,47?/m1/s1 |
| InChIKey | XZUQCXXXXCHIRX-WLUFAVRUSA-N |
| XLogP | 0.93 |
| TPSA | 212.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.06 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|