C52H34O7 — CID 163766760
7,9-dinaphthalen-2-yl-10-[3-(4-phenylphenyl)phenyl]anthracene-1,2,3,4,5,6,8-heptol (PubChem CID 163766760) has the molecular formula C52H34O7 and a molecular weight of 770.84 g/mol. Its IUPAC name is 7,9-dinaphthalen-2-yl-10-[3-(4-phenylphenyl)phenyl]anthracene-1,2,3,4,5,6,8-heptol.
| Compound Name | 7,9-dinaphthalen-2-yl-10-[3-(4-phenylphenyl)phenyl]anthracene-1,2,3,4,5,6,8-heptol |
|---|---|
| PubChem CID | 163766760 |
| Molecular Formula | C52H34O7 |
| Molecular Weight | 770.84 g/mol |
| Exact Mass | 770.23 |
| IUPAC Name | 7,9-dinaphthalen-2-yl-10-[3-(4-phenylphenyl)phenyl]anthracene-1,2,3,4,5,6,8-heptol |
| SMILES | Oc1c(O)c(O)c2c(-c3ccc4ccccc4c3)c3c(O)c(-c4ccc5ccccc5c4)c(O)c(O)c3c(-c3cccc(-c4ccc(-c5ccccc5)cc4)c3)c2c1O |
| InChI | InChI=1S/C52H34O7/c53-46-41(38-24-22-30-12-5-7-14-34(30)27-38)47(54)48(55)43-39(36-16-8-15-35(25-36)32-19-17-31(18-20-32)28-9-2-1-3-10-28)44-45(50(57)52(59)51(58)49(44)56)40(42(43)46)37-23-21-29-11-4-6-13-33(29)26-37/h1-27,53-59H |
| InChIKey | MCYYDMYBSQBGLO-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.84 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|