C19H33NO5 — CID 163769362
(2R,3R,4R,5S)-1-[(4-hexoxycyclohexa-1,3-dien-1-yl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 163769362) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[(4-hexoxycyclohexa-1,3-dien-1-yl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[(4-hexoxycyclohexa-1,3-dien-1-yl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 163769362 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (2R,3R,4R,5S)-1-[(4-hexoxycyclohexa-1,3-dien-1-yl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CCCCCCOC1=CC=C(CN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)CC1 |
| InChI | InChI=1S/C19H33NO5/c1-2-3-4-5-10-25-15-8-6-14(7-9-15)11-20-12-17(22)19(24)18(23)16(20)13-21/h6,8,16-19,21-24H,2-5,7,9-13H2,1H3/t16-,17+,18-,19-/m1/s1 |
| InChIKey | MFBZMNCIKICSLZ-FCGDIQPGSA-N |
| XLogP | 0.95 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|