C20H35NO5 — CID 143334577
(2R,3R,4R,5S)-1-[(2E,3Z)-5-butoxy-4-methyl-2-propylidenehexa-3,5-dienyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 143334577) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[(2E,3Z)-5-butoxy-4-methyl-2-propylidenehexa-3,5-dienyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[(2E,3Z)-5-butoxy-4-methyl-2-propylidenehexa-3,5-dienyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 143334577 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | (2R,3R,4R,5S)-1-[(2E,3Z)-5-butoxy-4-methyl-2-propylidenehexa-3,5-dienyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | C=C(OCCCC)/C(C)=C\C(=C/CC)CN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C20H35NO5/c1-5-7-9-26-15(4)14(3)10-16(8-6-2)11-21-12-18(23)20(25)19(24)17(21)13-22/h8,10,17-20,22-25H,4-7,9,11-13H2,1-3H3/b14-10-,16-8+/t17-,18+,19-,20-/m1/s1 |
| InChIKey | DEMFNIVGUPNKAD-NATCLOQHSA-N |
| XLogP | 1.36 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|