C18H31NO3 — CID 157039667
1-[(4Z)-4-ethenyl-6-propoxyhepta-4,6-dienyl]-2-(hydroxymethyl)piperidin-4-ol (PubChem CID 157039667) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-[(4Z)-4-ethenyl-6-propoxyhepta-4,6-dienyl]-2-(hydroxymethyl)piperidin-4-ol.
| Compound Name | 1-[(4Z)-4-ethenyl-6-propoxyhepta-4,6-dienyl]-2-(hydroxymethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 157039667 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 1-[(4Z)-4-ethenyl-6-propoxyhepta-4,6-dienyl]-2-(hydroxymethyl)piperidin-4-ol |
| SMILES | C=C/C(=C\C(=C)OCCC)CCCN1CCC(O)CC1CO |
| InChI | InChI=1S/C18H31NO3/c1-4-11-22-15(3)12-16(5-2)7-6-9-19-10-8-18(21)13-17(19)14-20/h5,12,17-18,20-21H,2-4,6-11,13-14H2,1H3/b16-12+ |
| InChIKey | JIIDTDWMSUEHEG-FOWTUZBSSA-N |
| XLogP | 2.64 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|