C15H25NO2 — CID 157039783
1-[(4Z)-4-ethenylhepta-4,6-dienyl]-2-(hydroxymethyl)piperidin-4-ol (PubChem CID 157039783) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-2-(hydroxymethyl)piperidin-4-ol.
| Compound Name | 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-2-(hydroxymethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 157039783 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-2-(hydroxymethyl)piperidin-4-ol |
| SMILES | C=C/C=C(\C=C)CCCN1CCC(O)CC1CO |
| InChI | InChI=1S/C15H25NO2/c1-3-6-13(4-2)7-5-9-16-10-8-15(18)11-14(16)12-17/h3-4,6,14-15,17-18H,1-2,5,7-12H2/b13-6+ |
| InChIKey | XPPDHSJAKMTERG-AWNIVKPZSA-N |
| XLogP | 1.88 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|