C33H42N2O6 — CID 163769957
cyclohexa-2,4-dien-1-ylmethyl (2S)-2-(2,9-dihydro-1H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 163769957) has the molecular formula C33H42N2O6 and a molecular weight of 562.71 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-ylmethyl (2S)-2-(2,9-dihydro-1H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | cyclohexa-2,4-dien-1-ylmethyl (2S)-2-(2,9-dihydro-1H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 163769957 |
| Molecular Formula | C33H42N2O6 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | cyclohexa-2,4-dien-1-ylmethyl (2S)-2-(2,9-dihydro-1H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OCC1C2=C(C=CCC2)c2ccccc21)C(=O)OCC1C=CC=CC1 |
| InChI | InChI=1S/C33H42N2O6/c1-33(2,3)41-31(37)34-20-12-11-19-29(30(36)39-21-23-13-5-4-6-14-23)35-32(38)40-22-28-26-17-9-7-15-24(26)25-16-8-10-18-27(25)28/h4-9,13,15-17,23,28-29H,10-12,14,18-22H2,1-3H3,(H,34,37)(H,35,38)/t23?,28?,29-/m0/s1 |
| InChIKey | MFOHJJDGKDBIFD-XMJNPIQJSA-N |
| XLogP | 6.35 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|