C28H28F3N2O4+ — CID 163770683
2-[2-[2-[[4-[3-(aminomethyl)phenyl]-2-(trifluoromethyl)-1H-indol-6-yl]methoxy]phenyl]acetyl]oxyethyl-methyloxidanium (PubChem CID 163770683) has the molecular formula C28H28F3N2O4+ and a molecular weight of 513.54 g/mol. Its IUPAC name is 2-[2-[2-[[4-[3-(aminomethyl)phenyl]-2-(trifluoromethyl)-1H-indol-6-yl]methoxy]phenyl]acetyl]oxyethyl-methyloxidanium.
| Compound Name | 2-[2-[2-[[4-[3-(aminomethyl)phenyl]-2-(trifluoromethyl)-1H-indol-6-yl]methoxy]phenyl]acetyl]oxyethyl-methyloxidanium |
|---|---|
| PubChem CID | 163770683 |
| Molecular Formula | C28H28F3N2O4+ |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 2-[2-[2-[[4-[3-(aminomethyl)phenyl]-2-(trifluoromethyl)-1H-indol-6-yl]methoxy]phenyl]acetyl]oxyethyl-methyloxidanium |
| SMILES | C[OH+]CCOC(=O)Cc1ccccc1OCc1cc(-c2cccc(CN)c2)c2cc(C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C28H27F3N2O4/c1-35-9-10-36-27(34)14-21-6-2-3-8-25(21)37-17-19-12-22(20-7-4-5-18(11-20)16-32)23-15-26(28(29,30)31)33-24(23)13-19/h2-8,11-13,15,33H,9-10,14,16-17,32H2,1H3/p+1 |
| InChIKey | MGDOEPXPKQZFHU-UHFFFAOYSA-O |
| XLogP | 5.13 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|