C15H19NO2 — CID 163774304
2-[(E)-6-hydroxyoct-4-enimidoyl]benzaldehyde (PubChem CID 163774304) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-[(E)-6-hydroxyoct-4-enimidoyl]benzaldehyde.
| Compound Name | 2-[(E)-6-hydroxyoct-4-enimidoyl]benzaldehyde |
|---|---|
| PubChem CID | 163774304 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[(E)-6-hydroxyoct-4-enimidoyl]benzaldehyde |
| SMILES | [H]/N=C(\CC/C=C/C(O)CC)c1ccccc1C=O |
| InChI | InChI=1S/C15H19NO2/c1-2-13(18)8-4-6-10-15(16)14-9-5-3-7-12(14)11-17/h3-5,7-9,11,13,16,18H,2,6,10H2,1H3/b8-4+,16-15+ |
| InChIKey | MJBXYGGNXCLMGK-FESCQNLSSA-N |
| XLogP | 2.97 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|