About ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane
ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane (PubChem CID 143427772) has the molecular formula C16H27NV
and a molecular weight of 284.34 g/mol. Its IUPAC name is ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane.
Molecular Properties
| Compound Name | ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane |
| PubChem CID | 143427772 |
| Molecular Formula | C16H27NV |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane |
| SMILES | CC.CCC(C)C.[H]/N=C(\C)c1ccccc1C=[V] |
| InChI | InChI=1S/C9H9N.C5H12.C2H6.V/c1-7-5-3-4-6-9(7)8(2)10;1-4-5(2)3;1-2;/h1,3-6,10H,2H3;5H,4H2,1-3H3;1-2H3;/b10-8+;;; |
| InChIKey | YOXLVOMYXPMWEK-WDMODZRLSA-N |
| XLogP | 4.85 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane?
The IUPAC name of ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane (CID 143427772) is ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane.
What is the SMILES notation for ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane?
The canonical SMILES for ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane is CC.CCC(C)C.[H]/N=C(\C)c1ccccc1C=[V].
What is the InChIKey of ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane?
The InChIKey is YOXLVOMYXPMWEK-WDMODZRLSA-N. The full InChI is InChI=1S/C9H9N.C5H12.C2H6.V/c1-7-5-3-4-6-9(7)8(2)10;1-4-5(2)3;1-2;/h1,3-6,10H,2H3;5H,4H2,1-3H3;1-2H3;/b10-8+;;;.
What are the key properties of ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane?
ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane has a molecular weight of 284.34 g/mol, XLogP of 4.85, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-ethanimidoylphenyl)methylidenevanadium;2-methylbutane is sourced from PubChem (CID 143427772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).